CAS 38436-14-5 appears in our catalog under these names: 1H,1H,2H,2H-Perfluorohexyl bromide, 95%, 6-Bromo-1,1,1,2,2,3,3,4,4-nonafluorohexane. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100g, 25g, 5g.
6-bromo-1,1,1,2,2,3,3,4,4-nonafluorohexane (CAS 38436-14-5) is a chemical compound with the molecular formula C6H4BrF9 and a molecular weight of 326.99 g/mol. IUPAC name: 6-bromo-1,1,1,2,2,3,3,4,4-nonafluorohexane. InChIKey: UDFSAZKDTBRQDY-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF9 |
|---|---|
| Molecular weight | 326.99 g/mol |
| IUPAC name | 6-bromo-1,1,1,2,2,3,3,4,4-nonafluorohexane |
| InChIKey | UDFSAZKDTBRQDY-UHFFFAOYSA-N |
| SMILES | C(CBr)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)