CAS 38436-17-8 appears in our catalog under these names: 1H,1H,1H,2H,2H-Nonafluorohexane, 95%, 1,1,1,2,2,3,3,4,4-Nonafluorohexane, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g, 100g.
1,1,1,2,2,3,3,4,4-nonafluorohexane (CAS 38436-17-8) is a chemical compound with the molecular formula C6H5F9 and a molecular weight of 248.09 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonafluorohexane. InChIKey: RTGGFPLAKRCINA-UHFFFAOYSA-N.
| Molecular formula | C6H5F9 |
|---|---|
| Molecular weight | 248.09 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonafluorohexane |
| InChIKey | RTGGFPLAKRCINA-UHFFFAOYSA-N |
| SMILES | CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)