Products 38474-04-3

CAS 38474-04-3 is the registry number for tert-Butyl 3-Methoxyphenyl sulfide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-tert-butylsulfanyl-3-methoxybenzene (CAS 38474-04-3) is a chemical compound with the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. IUPAC name: 1-tert-butylsulfanyl-3-methoxybenzene. InChIKey: XPYQZSWLUOZVJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16OS
Molecular weight196.31 g/mol
IUPAC name1-tert-butylsulfanyl-3-methoxybenzene
InChIKeyXPYQZSWLUOZVJZ-UHFFFAOYSA-N
SMILESCC(C)(C)SC1=CC=CC(=C1)OC

Computed by PubChem (NCBI)