CAS 384820-17-1 is the registry number for p38 MAP Kinase-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[2-(2-bromophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine (CAS 384820-17-1) is a chemical compound with the molecular formula C20H13BrFN3 and a molecular weight of 394.2 g/mol. IUPAC name: 4-[2-(2-bromophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine. InChIKey: COVWDRBCMJOSQM-UHFFFAOYSA-N.
| Molecular formula | C20H13BrFN3 |
|---|---|
| Molecular weight | 394.2 g/mol |
| IUPAC name | 4-[2-(2-bromophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
| InChIKey | COVWDRBCMJOSQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F)Br |
Computed by PubChem (NCBI)