Products 38524-44-6

CAS 38524-44-6 appears in our catalog under these names: O-(2,4-Dibromopropyl) O-Ethyl S-Propylphosphorothioate, >95% (HPLC), O-(2,4-Dibromophenyl) O-Ethyl S-Propyl Phosphorothioate, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.

Structural formula: {0} (CAS {1})

2,4-dibromo-1-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene (CAS 38524-44-6) is a chemical compound with the molecular formula C11H15Br2O3PS and a molecular weight of 418.08 g/mol. IUPAC name: 2,4-dibromo-1-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene. InChIKey: ULXWTNNUJQZNKI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15Br2O3PS
Molecular weight418.08 g/mol
IUPAC name2,4-dibromo-1-[ethoxy(propylsulfanyl)phosphoryl]oxybenzene
InChIKeyULXWTNNUJQZNKI-UHFFFAOYSA-N
SMILESCCCSP(=O)(OCC)OC1=C(C=C(C=C1)Br)Br

Computed by PubChem (NCBI)