CAS 3853-91-6 appears in our catalog under these names: Pentamethyliodobenzene, 97%, Pentamethyliodobenzene, Pentamethyliodobenzene/ 98%, 1-Iodo-2,3,4,5,6-pentamethylbenzene 98%, 1-Iodo-2,3,4,5,6-pentamethylbenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g.
1-iodo-2,3,4,5,6-pentamethylbenzene (CAS 3853-91-6) is a chemical compound with the molecular formula C11H15I and a molecular weight of 274.14 g/mol. IUPAC name: 1-iodo-2,3,4,5,6-pentamethylbenzene. InChIKey: UXHBVYKGPRUHKM-UHFFFAOYSA-N.
| Molecular formula | C11H15I |
|---|---|
| Molecular weight | 274.14 g/mol |
| IUPAC name | 1-iodo-2,3,4,5,6-pentamethylbenzene |
| InChIKey | UXHBVYKGPRUHKM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)I)C)C |
Computed by PubChem (NCBI)