CAS 38533-41-4 appears in our catalog under these names: Potassium 4-acetylphenyl sulfate, Potassium 4-acetylphenyl sulfate, 95+%. Offered by: Biosynth, Chemat Brand. Available pack sizes: 50g, on request.
Potassium (4-acetylphenyl) sulfate (CAS 38533-41-4) is a chemical compound with the molecular formula C8H7KO5S and a molecular weight of 254.30 g/mol. IUPAC name: potassium (4-acetylphenyl) sulfate. InChIKey: ROAAZPXPHLVGPY-UHFFFAOYSA-M.
| Molecular formula | C8H7KO5S |
|---|---|
| Molecular weight | 254.30 g/mol |
| IUPAC name | potassium (4-acetylphenyl) sulfate |
| InChIKey | ROAAZPXPHLVGPY-UHFFFAOYSA-M |
| SMILES | CC(=O)C1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)