CAS 3854-04-4 appears in our catalog under these names: Oxotremorine M iodide, 98%, Oxotremorine M (iodide), Oxotremorine M, Oxotremorine M iodide, Oxotremorine M (iodide). Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 50mg, 10mg, 10mM * 1ml in dmso, 10mM (in 1ml dmso), 1mg, 5 mg.
Trimethyl-[4-(2-oxopyrrolidin-1-yl)but-3-ynyl]azanium iodide (CAS 3854-04-4) is a chemical compound with the molecular formula C11H19IN2O and a molecular weight of 322.19 g/mol. IUPAC name: trimethyl-[4-(2-oxopyrrolidin-1-yl)but-3-ynyl]azanium iodide. InChIKey: CHRKORSYUQVKAQ-UHFFFAOYSA-M.
| Molecular formula | C11H19IN2O |
|---|---|
| Molecular weight | 322.19 g/mol |
| IUPAC name | trimethyl-[4-(2-oxopyrrolidin-1-yl)but-3-ynyl]azanium iodide |
| InChIKey | CHRKORSYUQVKAQ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCC#CN1CCCC1=O.[I-] |
Computed by PubChem (NCBI)