CAS 38550-34-4 appears in our catalog under these names: 2-Iodo-1h,1h,1h,2h,3h,3h-perfluorononane, 95%, 2-Iodo-1H,1H,1H,2H,3H,3H-Perfluorononane, 2-Iodo-1H,1H,1H,2H,3H,3H-perfluorononane, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane (CAS 38550-34-4) is a chemical compound with the molecular formula C9H6F13I and a molecular weight of 488.03 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane. InChIKey: REPFTMOJFHVIBT-UHFFFAOYSA-N.
| Molecular formula | C9H6F13I |
|---|---|
| Molecular weight | 488.03 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane |
| InChIKey | REPFTMOJFHVIBT-UHFFFAOYSA-N |
| SMILES | CC(CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)I |
Computed by PubChem (NCBI)