CAS 38565-54-7 appears in our catalog under these names: 3-PERFLUORODECYL-1,2-EPOXYPROPANE, ≥97%, ≥97%, 3-(Perfluoro-n-decyl)-1,2-propenoxide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)oxirane (CAS 38565-54-7) is a chemical compound with the molecular formula C13H5F21O and a molecular weight of 576.14 g/mol. IUPAC name: 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)oxirane. InChIKey: KVLHRMQNRDJRKW-UHFFFAOYSA-N.
| Molecular formula | C13H5F21O |
|---|---|
| Molecular weight | 576.14 g/mol |
| IUPAC name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecyl)oxirane |
| InChIKey | KVLHRMQNRDJRKW-UHFFFAOYSA-N |
| SMILES | C1C(O1)CC(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)