CAS 38568-21-7 is the registry number for 2,2-Dibromohexafluoropropane. Offered by: TRC. Available pack sizes: 250mg.
2,2-dibromo-1,1,1,3,3,3-hexafluoropropane (CAS 38568-21-7) is a chemical compound with the molecular formula C3Br2F6 and a molecular weight of 309.83 g/mol. IUPAC name: 2,2-dibromo-1,1,1,3,3,3-hexafluoropropane. InChIKey: VCRVQFFAKUROKA-UHFFFAOYSA-N.
| Molecular formula | C3Br2F6 |
|---|---|
| Molecular weight | 309.83 g/mol |
| IUPAC name | 2,2-dibromo-1,1,1,3,3,3-hexafluoropropane |
| InChIKey | VCRVQFFAKUROKA-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)(Br)Br |
Computed by PubChem (NCBI)