CAS 385784-71-4 appears in our catalog under these names: 5-Methoxy-4-(3-morpholinopropoxy)-2-nitrobenzonitrile, 95%, Gefitinib Impurity 47, Gefitinib Impurity 82. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-methoxy-4-(3-morpholin-4-ylpropoxy)-2-nitrobenzonitrile (CAS 385784-71-4) is a chemical compound with the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. IUPAC name: 5-methoxy-4-(3-morpholin-4-ylpropoxy)-2-nitrobenzonitrile. InChIKey: KVQSBVVAIIZDRJ-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O5 |
|---|---|
| Molecular weight | 321.33 g/mol |
| IUPAC name | 5-methoxy-4-(3-morpholin-4-ylpropoxy)-2-nitrobenzonitrile |
| InChIKey | KVQSBVVAIIZDRJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C#N)[N+](=O)[O-])OCCCN2CCOCC2 |
Computed by PubChem (NCBI)