CAS 385786-48-1 appears in our catalog under these names: Adaptaquin, HIF Prolyl Hydroxylase Inhib 1PC X 10MG, 7-((4-Chlorophenyl)((3-hydroxypyridin-2-yl)amino)methyl)quinolin-8-ol, 97%, 97%, Adaptaquin, 99.87%, Adaptaquin (Standard). Offered by: TRC, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso), 50 mg.
7-[(4-chlorophenyl)-[(3-hydroxy-2-pyridinyl)amino]methyl]quinolin-8-ol (CAS 385786-48-1) is a chemical compound with the molecular formula C21H16ClN3O2 and a molecular weight of 377.8 g/mol. IUPAC name: 7-[(4-chlorophenyl)-[(3-hydroxy-2-pyridinyl)amino]methyl]quinolin-8-ol. InChIKey: KKYHNYRUBSYTCZ-UHFFFAOYSA-N.
| Molecular formula | C21H16ClN3O2 |
|---|---|
| Molecular weight | 377.8 g/mol |
| IUPAC name | 7-[(4-chlorophenyl)-[(3-hydroxy-2-pyridinyl)amino]methyl]quinolin-8-ol |
| InChIKey | KKYHNYRUBSYTCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)C(C3=CC=C(C=C3)Cl)NC4=C(C=CC=N4)O)O)N=C1 |
Computed by PubChem (NCBI)