CAS 38580-86-8 appears in our catalog under these names: 2,4,6-Triisopropylbenzyl chloride, 95%, 2-(Chloromethyl)-1,3,5-triisopropylbenzene, 98%, 2,4,6–Triisopropylbenzyl Chloride, 2,4,6-Triisopropylbenzyl Chloride, >98.0%(GC), 2,4,6-Triisopropylbenzyl Chloride, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg.
2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene (CAS 38580-86-8) is a chemical compound with the molecular formula C16H25Cl and a molecular weight of 252.82 g/mol. IUPAC name: 2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene. InChIKey: CQHQLMOCMQMZPP-UHFFFAOYSA-N.
| Molecular formula | C16H25Cl |
|---|---|
| Molecular weight | 252.82 g/mol |
| IUPAC name | 2-(chloromethyl)-1,3,5-tri(propan-2-yl)benzene |
| InChIKey | CQHQLMOCMQMZPP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)CCl)C(C)C |
Computed by PubChem (NCBI)