CAS 38589-89-8 is the registry number for (S)–2–Amino–3–(4–isobutoxyphenyl)propanoic acid. Offered by: GLPBio. Available pack sizes: 1g.
(2S)-2-amino-3-[4-(2-methylpropoxy)phenyl]propanoic acid (CAS 38589-89-8) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: (2S)-2-amino-3-[4-(2-methylpropoxy)phenyl]propanoic acid. InChIKey: YIACUWYMFUHIMC-LBPRGKRZSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(2-methylpropoxy)phenyl]propanoic acid |
| InChIKey | YIACUWYMFUHIMC-LBPRGKRZSA-N |
| SMILES | CC(C)COC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)