CAS 3866-79-3 appears in our catalog under these names: Trimethylene di(thiotosylate), 95%, 1,3-Propanedithiol ditosylate, 95%, Trimethylene Di(thiotosylate), S,S'–Trimethylene di(|p|–toluenethiosulfonate), Trimethylene Di(thiotosylate) [Protecting Reagent for Active Methylene], >95.0%(HPLC). Offered by: Combi-blocks, AmBeed, TRC, GLPBio, TCI. Available pack sizes: 1g, 25g, 5g, 2,5g.
1-methyl-4-[3-(4-methylphenyl)sulfonylsulfanylpropylsulfanylsulfonyl]benzene (CAS 3866-79-3) is a chemical compound with the molecular formula C17H20O4S4 and a molecular weight of 416.6 g/mol. IUPAC name: 1-methyl-4-[3-(4-methylphenyl)sulfonylsulfanylpropylsulfanylsulfonyl]benzene. InChIKey: QOICHLMIPNOKLN-UHFFFAOYSA-N.
| Molecular formula | C17H20O4S4 |
|---|---|
| Molecular weight | 416.6 g/mol |
| IUPAC name | 1-methyl-4-[3-(4-methylphenyl)sulfonylsulfanylpropylsulfanylsulfonyl]benzene |
| InChIKey | QOICHLMIPNOKLN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)SCCCSS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)