CAS 38675-79-5 is the registry number for Ebastine Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(4-tert-butylphenyl)-cyclopropylmethanone (CAS 38675-79-5) is a chemical compound with the molecular formula C14H18O and a molecular weight of 202.29 g/mol. IUPAC name: (4-tert-butylphenyl)-cyclopropylmethanone. InChIKey: XVDLXILLBPXUPJ-UHFFFAOYSA-N.
| Molecular formula | C14H18O |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | (4-tert-butylphenyl)-cyclopropylmethanone |
| InChIKey | XVDLXILLBPXUPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)C2CC2 |
Computed by PubChem (NCBI)