CAS 386750-22-7 appears in our catalog under these names: Desvenlafaxine succinate monohydrate, 95%, Desvenlafaxine Succinate Monohydrate (O-Desmethylvenlafaxine Succinate Monohydrate), Desvenlafaxine Succinate, Desvenlafaxine succinate hydrate/ 99.39% (existing batch purity), Desvenlafaxine succinate, 98.00%. Offered by: Combi-blocks, Mikromol, LoGiCal, GLPBio, TargetMol. Available pack sizes: 1g, 250mg, 100mg, 10mg, 10mM (in 1ml dmso), 500mg, 5mg, 25mg.
Butanedioic acid;4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;hydrate (CAS 386750-22-7) is a chemical compound with the molecular formula C20H33NO7 and a molecular weight of 399.5 g/mol. IUPAC name: butanedioic acid;4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;hydrate. InChIKey: PWPDEXVGKDEKTE-UHFFFAOYSA-N.
| Molecular formula | C20H33NO7 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | butanedioic acid;4-[2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol;hydrate |
| InChIKey | PWPDEXVGKDEKTE-UHFFFAOYSA-N |
| SMILES | CN(C)CC(C1=CC=C(C=C1)O)C2(CCCCC2)O.C(CC(=O)O)C(=O)O.O |
Computed by PubChem (NCBI)