CAS 3868-32-4 appears in our catalog under these names: 8-Aminoguanosine, 95%, 8-Aminoguanosine, >95% (HPLC), 8–Aminoguanosine, 8-Aminoguanosine. Offered by: Combi-blocks, TRC, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g, 0,25g, 2g.
2,8-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 3868-32-4) is a chemical compound with the molecular formula C10H14N6O5 and a molecular weight of 298.26 g/mol. IUPAC name: 2,8-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: FNXPTCITVCRFRK-UMMCILCDSA-N.
| Molecular formula | C10H14N6O5 |
|---|---|
| Molecular weight | 298.26 g/mol |
| IUPAC name | 2,8-diamino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | FNXPTCITVCRFRK-UMMCILCDSA-N |
| SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N2C3=C(C(=O)NC(=N3)N)N=C2N)O)O)O |
Computed by PubChem (NCBI)