CAS 38691-95-1 appears in our catalog under these names: Groenlandicine, Groenlandicine Bromide, Groenlandicine/ 99.03% (existing batch purity), Groenlandicine, 98%, 98%, Groenlandicine, 99.87%. Offered by: GLPBio, Chemat Brand, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, on request, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg.
16-methoxy-5,7-dioxa-1-azoniapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-ol (CAS 38691-95-1) is a chemical compound with the molecular formula C19H16NO4+ and a molecular weight of 322.3 g/mol. IUPAC name: 16-methoxy-5,7-dioxa-1-azoniapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-ol. InChIKey: PGIOBGCIEGZHJH-UHFFFAOYSA-O.
| Molecular formula | C19H16NO4+ |
|---|---|
| Molecular weight | 322.3 g/mol |
| IUPAC name | 16-methoxy-5,7-dioxa-1-azoniapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-ol |
| InChIKey | PGIOBGCIEGZHJH-UHFFFAOYSA-O |
| SMILES | COC1=C(C=C2CC[N+]3=C(C2=C1)C=C4C=CC5=C(C4=C3)OCO5)O |
Computed by PubChem (NCBI)