CAS 387-41-7 is the registry number for 2,6-Dichlorobenzenediazonium Tetrafluoroborate. Offered by: TRC. Available pack sizes: 500mg.
2,6-dichlorobenzenediazonium tetrafluoroborate (CAS 387-41-7) is a chemical compound with the molecular formula C6H3BCl2F4N2 and a molecular weight of 260.81 g/mol. IUPAC name: 2,6-dichlorobenzenediazonium tetrafluoroborate. InChIKey: SRGRGNRKFZLMBT-UHFFFAOYSA-N.
| Molecular formula | C6H3BCl2F4N2 |
|---|---|
| Molecular weight | 260.81 g/mol |
| IUPAC name | 2,6-dichlorobenzenediazonium tetrafluoroborate |
| InChIKey | SRGRGNRKFZLMBT-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C1=CC(=C(C(=C1)Cl)[N+]#N)Cl |
Computed by PubChem (NCBI)