CAS 3871-20-3 appears in our catalog under these names: Tris(4-nitrophenyl) phosphate, 96%, Tris(4-nitrophenyl) phosphate, 98%, Tris(4-nitrophenyl)phosphate, Tris(4–nitrophenyl) Phosphate, Tris(4-nitrophenyl) Phosphate, >98.0%(HPLC)(T). Offered by: Combi-blocks, AmBeed, TRC, GLPBio, TCI. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 250mg.
Tris(4-nitrophenyl) phosphate (CAS 3871-20-3) is a chemical compound with the molecular formula C18H12N3O10P and a molecular weight of 461.3 g/mol. IUPAC name: tris(4-nitrophenyl) phosphate. InChIKey: RZSPPBDBWOJRII-UHFFFAOYSA-N.
| Molecular formula | C18H12N3O10P |
|---|---|
| Molecular weight | 461.3 g/mol |
| IUPAC name | tris(4-nitrophenyl) phosphate |
| InChIKey | RZSPPBDBWOJRII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(OC2=CC=C(C=C2)[N+](=O)[O-])OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)