CAS 3871-99-6 appears in our catalog under these names: Perfluorohexanesulfonic acid potassium salt, 95%, Tridecafluorohexanesulfonic Acid Potassium Salt (Mixture of Isomers), >95% (HPLC), Tridecafluorohexane–1–sulfonic acid potassium salt, Potassium perfluorohexanesulfonate, Tridecafluorohexane-1-sulfonic acid potassium salt, Concentration: 50.0 µg/ml Solvent: Methanol. Offered by: Combi-blocks, TRC, GLPBio, Sigma-Aldrich, HPC Standards. Available pack sizes: 1g, 250mg, 500mg, 50mg, 100mg, 10MG, 1x1ml, 1x100mg.
Potassium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (CAS 3871-99-6) is a chemical compound with the molecular formula C6F13KO3S and a molecular weight of 438.21 g/mol. IUPAC name: potassium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate. InChIKey: RSCGQEBKFSGWJT-UHFFFAOYSA-M.
| Molecular formula | C6F13KO3S |
|---|---|
| Molecular weight | 438.21 g/mol |
| IUPAC name | potassium 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| InChIKey | RSCGQEBKFSGWJT-UHFFFAOYSA-M |
| SMILES | C(C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(F)F)(C(C(F)(F)F)(F)F)(F)F.[K+] |
Computed by PubChem (NCBI)