CAS 3875-70-5 appears in our catalog under these names: Indigosol o, disodium salt, 95%, Sodium 1H,1'H-[2,2'-biindole]-3,3'-diyl bis(sulfate), 97%, Indigosol O Disodium Salt, Indigosol O, disodium salt. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth. Available pack sizes: 100mg, 1g, 250mg, on request, 500mg, 50mg.
Disodium;[2-(3-sulfonatooxy-1H-indol-2-yl)-1H-indol-3-yl] sulfate (CAS 3875-70-5) is a chemical compound with the molecular formula C16H10N2Na2O8S2 and a molecular weight of 468.4 g/mol. IUPAC name: disodium;[2-(3-sulfonatooxy-1H-indol-2-yl)-1H-indol-3-yl] sulfate. InChIKey: KFASJWBJXNIESC-UHFFFAOYSA-L.
| Molecular formula | C16H10N2Na2O8S2 |
|---|---|
| Molecular weight | 468.4 g/mol |
| IUPAC name | disodium;[2-(3-sulfonatooxy-1H-indol-2-yl)-1H-indol-3-yl] sulfate |
| InChIKey | KFASJWBJXNIESC-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=C(C4=CC=CC=C4N3)OS(=O)(=O)[O-])OS(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)