CAS 3878-44-2 appears in our catalog under these names: Triphenylphosphine Selenide, Triphenylphosphine Selenide, >98.0%(GC), Triphenylphosphine selenide 98%, Triphenylphosphine Selenide, 98%, 98%, TRIPHENYLPHOSPHINE SELENIDE, 98%+(GC-MS),RG. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 500g.
Triphenyl(selanylidene)-lambda5-phosphane (CAS 3878-44-2) is a chemical compound with the molecular formula C18H15PSe and a molecular weight of 341.3 g/mol. IUPAC name: triphenyl(selanylidene)-lambda5-phosphane. InChIKey: ZFVJLNKVUKIPPI-UHFFFAOYSA-N.
| Molecular formula | C18H15PSe |
|---|---|
| Molecular weight | 341.3 g/mol |
| IUPAC name | triphenyl(selanylidene)-lambda5-phosphane |
| InChIKey | ZFVJLNKVUKIPPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=[Se])(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)