Products 387832-36-2
CAS 387832-36-2 is the registry number for Antibacterial agent 192. Offered by: MedChemExpress. Available pack sizes: Get quote.
5'-bromo-1'-methyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (CAS 387832-36-2) is a chemical compound with the molecular formula C16H12BrN3OS and a molecular weight of 374.3 g/mol. IUPAC name: 5'-bromo-1'-methyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one. InChIKey: GEXAYXAKZPOPPW-UHFFFAOYSA-N.
| Molecular formula | C16H12BrN3OS |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5'-bromo-1'-methyl-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| InChIKey | GEXAYXAKZPOPPW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C3(C1=O)NN=C(S3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)