CAS 387882-95-3 is the registry number for 2-(2-Fluoro-5-nitrophenyl)-3a,4,7,7a-tetrahydro-1H-isoindole-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-fluoro-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (CAS 387882-95-3) is a chemical compound with the molecular formula C14H11FN2O4 and a molecular weight of 290.25 g/mol. IUPAC name: 2-(2-fluoro-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione. InChIKey: IBYNIGIJFVEIBT-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O4 |
|---|---|
| Molecular weight | 290.25 g/mol |
| IUPAC name | 2-(2-fluoro-5-nitrophenyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| InChIKey | IBYNIGIJFVEIBT-UHFFFAOYSA-N |
| SMILES | C1C=CCC2C1C(=O)N(C2=O)C3=C(C=CC(=C3)[N+](=O)[O-])F |
Computed by PubChem (NCBI)