CAS 38791-68-3 is the registry number for 4,4′-[1,4-Phenylenebis(oxy)]bis[1,2-benzenedicarbonitrile], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-[4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile (CAS 38791-68-3) is a chemical compound with the molecular formula C22H10N4O2 and a molecular weight of 362.3 g/mol. IUPAC name: 4-[4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile. InChIKey: GSELOSLCLAWQDJ-UHFFFAOYSA-N.
| Molecular formula | C22H10N4O2 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | 4-[4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
| InChIKey | GSELOSLCLAWQDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)C#N)C#N)OC3=CC(=C(C=C3)C#N)C#N |
Computed by PubChem (NCBI)