CAS 38800-20-3 appears in our catalog under these names: 2,3–Diphenyl–5–(2–thienyl)tetrazolium Chloride, 2,3-Diphenyl-5-(2-thienyl)tetrazolium Chloride, >97.0%(HPLC)(T), 2,3-Diphenyl-5-(thiophen-2-yl)-2H-tetrazol-3-ium chloride, 97.0%, 97.0%, 2,3-Diphenyl-5-(thiophen-2-yl)-2H-tetrazol-3-ium chloride, ≥97%(HPLC)(T). Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 1g.
2,3-diphenyl-5-thiophen-2-yltetrazol-2-ium chloride (CAS 38800-20-3) is a chemical compound with the molecular formula C17H13ClN4S and a molecular weight of 340.8 g/mol. IUPAC name: 2,3-diphenyl-5-thiophen-2-yltetrazol-2-ium chloride. InChIKey: RLHVMOZOYHDIGV-UHFFFAOYSA-M.
| Molecular formula | C17H13ClN4S |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | 2,3-diphenyl-5-thiophen-2-yltetrazol-2-ium chloride |
| InChIKey | RLHVMOZOYHDIGV-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)N2N=C(N=[N+]2C3=CC=CC=C3)C4=CC=CS4.[Cl-] |
Computed by PubChem (NCBI)