CAS 38838-07-2 is the registry number for Capecitabine Intermediate 2 . Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(3aR,4R,6S,6aS)-6-(chloromethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (CAS 38838-07-2) is a chemical compound with the molecular formula C9H15ClO4 and a molecular weight of 222.66 g/mol. IUPAC name: (3aR,4R,6S,6aS)-6-(chloromethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole. InChIKey: IKMCNTFVIGEWGJ-WCTZXXKLSA-N.
| Molecular formula | C9H15ClO4 |
|---|---|
| Molecular weight | 222.66 g/mol |
| IUPAC name | (3aR,4R,6S,6aS)-6-(chloromethyl)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| InChIKey | IKMCNTFVIGEWGJ-WCTZXXKLSA-N |
| SMILES | CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)OC)CCl)C |
Computed by PubChem (NCBI)