CAS 38841-98-4 appears in our catalog under these names: 1–Octylmagnesium chloride, Octylmagnesium chloride, 1.4M solution in THF, AcroSeal®, OCTYLMAGNESIUM CHLORIDE, 2.0M SOLUTION &. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ml, 500ml, 800ML.
Magnesium;octane;chloride (CAS 38841-98-4) is a chemical compound with the molecular formula C8H17ClMg and a molecular weight of 172.98 g/mol. IUPAC name: magnesium;octane;chloride. InChIKey: HQDAZWQQKSJCTM-UHFFFAOYSA-M.
| Molecular formula | C8H17ClMg |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | magnesium;octane;chloride |
| InChIKey | HQDAZWQQKSJCTM-UHFFFAOYSA-M |
| SMILES | CCCCCCC[CH2-].[Mg+2].[Cl-] |
Computed by PubChem (NCBI)