CAS 3886-78-0 is the registry number for rel-(1S,4R)-1-Methyl-4-(prop-1-en-2-yl)cyclohex-2-enol. Offered by: Chemat. Available pack sizes: 25mg, 100mg.
(1R,4S)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol (CAS 3886-78-0) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1R,4S)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol. InChIKey: MKPMHJQMNACGDI-ZJUUUORDSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1R,4S)-1-methyl-4-prop-1-en-2-ylcyclohex-2-en-1-ol |
| InChIKey | MKPMHJQMNACGDI-ZJUUUORDSA-N |
| SMILES | CC(=C)[C@H]1CC[C@@](C=C1)(C)O |
Computed by PubChem (NCBI)