CAS 3888-44-6 is the registry number for Sodium 4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate. Offered by: Chemat. Available pack sizes: 2.5kg, 1g, 5g, 25g, 100g, 500g.
Sodium 4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate (CAS 3888-44-6) is a chemical compound with the molecular formula C10H7NaO8S2 and a molecular weight of 342.3 g/mol. IUPAC name: sodium 4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate. InChIKey: UPYOFRGSTDARPV-UHFFFAOYSA-M.
| Molecular formula | C10H7NaO8S2 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | sodium 4,5-dihydroxy-7-sulfonaphthalene-2-sulfonate |
| InChIKey | UPYOFRGSTDARPV-UHFFFAOYSA-M |
| SMILES | C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)O)O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)