Products 389080-71-1
CAS 389080-71-1 is the registry number for MLS6585. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 25mg, 100mg, 5mg.
N-(6-tert-butyl-3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyridine-4-carboxamide (CAS 389080-71-1) is a chemical compound with the molecular formula C19H23N3O2S and a molecular weight of 357.5 g/mol. IUPAC name: N-(6-tert-butyl-3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyridine-4-carboxamide. InChIKey: IMEICQDRTCGLFX-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O2S |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | N-(6-tert-butyl-3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pyridine-4-carboxamide |
| InChIKey | IMEICQDRTCGLFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)N)NC(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)