CAS 389084-12-2 appears in our catalog under these names: 2-Nitro-1-(2-pyridylthio)-4-(trifluoromethyl)benzene, 2-Nitro-1-(2-pyridylthio)-4-(trifluoromethyl)benzene, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 25mg, 5g.
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpyridine (CAS 389084-12-2) is a chemical compound with the molecular formula C12H7F3N2O2S and a molecular weight of 300.26 g/mol. IUPAC name: 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpyridine. InChIKey: YYVHNASCJDCQPY-UHFFFAOYSA-N.
| Molecular formula | C12H7F3N2O2S |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylpyridine |
| InChIKey | YYVHNASCJDCQPY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SC2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)