Products 38910-73-5
CAS 38910-73-5 is the registry number for Nor Propoxyphene Maleate Salt. Offered by: TRC. Available pack sizes: 5mg.
(Z)-but-2-enedioic acid;[3-methyl-4-(methylamino)-1,2-diphenylbutan-2-yl] propanoate (CAS 38910-73-5) is a chemical compound with the molecular formula C25H31NO6 and a molecular weight of 441.5 g/mol. IUPAC name: (Z)-but-2-enedioic acid;[3-methyl-4-(methylamino)-1,2-diphenylbutan-2-yl] propanoate. InChIKey: HCQPFYNZJNOOKN-BTJKTKAUSA-N.
| Molecular formula | C25H31NO6 |
|---|---|
| Molecular weight | 441.5 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;[3-methyl-4-(methylamino)-1,2-diphenylbutan-2-yl] propanoate |
| InChIKey | HCQPFYNZJNOOKN-BTJKTKAUSA-N |
| SMILES | CCC(=O)OC(CC1=CC=CC=C1)(C2=CC=CC=C2)C(C)CNC.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)