CAS 38939-88-7 appears in our catalog under these names: 3–Chloro–4–nitrotoluene, 3-Chloro-4-nitrotoluene, >98.0%(GC), 3-Chloro-4-nitrotoluene, 2-Chloro-4-methyl-1-nitrobenzene 98%, 2-Chloro-4-methyl-1-nitrobenzene 98+%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 5g, 25g, 500g, 250g, 10g.
2-chloro-4-methyl-1-nitrobenzene (CAS 38939-88-7) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 2-chloro-4-methyl-1-nitrobenzene. InChIKey: KGSQRFPDZCBVBS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 2-chloro-4-methyl-1-nitrobenzene |
| InChIKey | KGSQRFPDZCBVBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)