CAS 38945-01-6 appears in our catalog under these names: Sodium thiophene-2-sulfinate 97%, Sodium thiophene-2-sulfinate, 97%, 97%, 2-Thiophenesulfinic acid sodium salt, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Sodium thiophene-2-sulfinate (CAS 38945-01-6) is a chemical compound with the molecular formula C4H3NaO2S2 and a molecular weight of 170.2 g/mol. IUPAC name: sodium thiophene-2-sulfinate. InChIKey: RRLLXOFIOPVYOP-UHFFFAOYSA-M.
| Molecular formula | C4H3NaO2S2 |
|---|---|
| Molecular weight | 170.2 g/mol |
| IUPAC name | sodium thiophene-2-sulfinate |
| InChIKey | RRLLXOFIOPVYOP-UHFFFAOYSA-M |
| SMILES | C1=CSC(=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)