CAS 389571-69-1 is the registry number for 3-Iodo-5-(trifluoromethyl)aniline, 95+%. Offered by: AmBeed. Available pack sizes: 250mg.
3-iodo-5-(trifluoromethyl)aniline (CAS 389571-69-1) is a chemical compound with the molecular formula C7H5F3IN and a molecular weight of 287.02 g/mol. IUPAC name: 3-iodo-5-(trifluoromethyl)aniline. InChIKey: AGFSYSXYGGUNCD-UHFFFAOYSA-N.
| Molecular formula | C7H5F3IN |
|---|---|
| Molecular weight | 287.02 g/mol |
| IUPAC name | 3-iodo-5-(trifluoromethyl)aniline |
| InChIKey | AGFSYSXYGGUNCD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1N)I)C(F)(F)F |
Computed by PubChem (NCBI)