Products 38965-71-8

CAS 38965-71-8 is the registry number for Aristolochic acid Ia. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

8-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid (CAS 38965-71-8) is a chemical compound with the molecular formula C16H9NO7 and a molecular weight of 327.24 g/mol. IUPAC name: 8-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid. InChIKey: LGZIKBZSCRORQN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9NO7
Molecular weight327.24 g/mol
IUPAC name8-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid
InChIKeyLGZIKBZSCRORQN-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C3=C4C=CC=C(C4=CC(=C3C(=C2)C(=O)O)[N+](=O)[O-])O

Computed by PubChem (NCBI)