CAS 389827-70-7 is the registry number for Benzyl (5-bromo-2,7-di-tert-butyl-9,9-dimethyl-9H-xanthen-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamate (CAS 389827-70-7) is a chemical compound with the molecular formula C31H36BrNO3 and a molecular weight of 550.5 g/mol. IUPAC name: benzyl N-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamate. InChIKey: CYLOEDMCDBYASI-UHFFFAOYSA-N.
| Molecular formula | C31H36BrNO3 |
|---|---|
| Molecular weight | 550.5 g/mol |
| IUPAC name | benzyl N-(5-bromo-2,7-ditert-butyl-9,9-dimethylxanthen-4-yl)carbamate |
| InChIKey | CYLOEDMCDBYASI-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C(=CC(=C2)C(C)(C)C)NC(=O)OCC3=CC=CC=C3)OC4=C1C=C(C=C4Br)C(C)(C)C)C |
Computed by PubChem (NCBI)