CAS 38985-69-2 is the registry number for 2-(4-Isothiocyanatophenyl)-6-methyl-1,3-benzothiazole. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 2,5g.
2-(4-isothiocyanatophenyl)-6-methyl-1,3-benzothiazole (CAS 38985-69-2) is a chemical compound with the molecular formula C15H10N2S2 and a molecular weight of 282.4 g/mol. IUPAC name: 2-(4-isothiocyanatophenyl)-6-methyl-1,3-benzothiazole. InChIKey: LDZBSJGNFLWZNJ-UHFFFAOYSA-N.
| Molecular formula | C15H10N2S2 |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-(4-isothiocyanatophenyl)-6-methyl-1,3-benzothiazole |
| InChIKey | LDZBSJGNFLWZNJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)N=C=S |
Computed by PubChem (NCBI)