CAS 39037-79-1 appears in our catalog under these names: Rel-1-((2R,3R)-3-methoxypiperidin-2-yl)propan-2-one, 98%, cis-(3-Methoxy-2-Piperidyl)-2-Propanone. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2R,3R)-3-methoxypiperidin-2-yl]propan-2-one (CAS 39037-79-1) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: 1-[(2R,3R)-3-methoxypiperidin-2-yl]propan-2-one. InChIKey: VNZVBGRNVIBWEU-RKDXNWHRSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 1-[(2R,3R)-3-methoxypiperidin-2-yl]propan-2-one |
| InChIKey | VNZVBGRNVIBWEU-RKDXNWHRSA-N |
| SMILES | CC(=O)C[C@@H]1[C@@H](CCCN1)OC |
Computed by PubChem (NCBI)