CAS 39080-67-6 appears in our catalog under these names: 7-Chloro-5-(2,6-difluorophenyl)-1,3-dihydro-1-methyl-2H-1,4-benzodiazepin-2-one, Difludiazepam, Difludiazepam, 98.9%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 50mg, 1 mg, 5 mg.
7-chloro-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (CAS 39080-67-6) is a chemical compound with the molecular formula C16H11ClF2N2O and a molecular weight of 320.72 g/mol. IUPAC name: 7-chloro-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one. InChIKey: DUNFPASORLTEGN-UHFFFAOYSA-N.
| Molecular formula | C16H11ClF2N2O |
|---|---|
| Molecular weight | 320.72 g/mol |
| IUPAC name | 7-chloro-5-(2,6-difluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | DUNFPASORLTEGN-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=C(C=CC=C3F)F |
Computed by PubChem (NCBI)