Products 39093-77-1

CAS 39093-77-1 appears in our catalog under these names: 4–Thiomorpholinecarbonyl chloride, 1,1–dioxide, Thiomorpholine-4-carbonyl Chloride 1,1-Dioxide, Thiomorpholine-4-carbonyl chloride 1,1-dioxide 97%, 4-THIOMORPHOLINECARBONYL CHLORIDE, 1,1-DIOXIDE, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.

Structural formula: {0} (CAS {1})

1,1-dioxo-1,4-thiazinane-4-carbonyl chloride (CAS 39093-77-1) is a chemical compound with the molecular formula C5H8ClNO3S and a molecular weight of 197.64 g/mol. IUPAC name: 1,1-dioxo-1,4-thiazinane-4-carbonyl chloride. InChIKey: IGTZDYSBSFTPPP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H8ClNO3S
Molecular weight197.64 g/mol
IUPAC name1,1-dioxo-1,4-thiazinane-4-carbonyl chloride
InChIKeyIGTZDYSBSFTPPP-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCN1C(=O)Cl

Computed by PubChem (NCBI)