Products 39098-75-4

CAS 39098-75-4 appears in our catalog under these names: 3-Cyclohexylpropionyl chloride, 98%, Cyclohexanepropanoyl Chloride, >98.0%(GC)(T), 3-Cyclohexylpropanoyl chloride 98%, Cyclohexanepropanoyl Chloride, 98%, 98%, 3-cyclohexylpropanoyl chloride, 98%. Offered by: Combi-blocks, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 5g, 25g, 1g, 10g, 50g.

Structural formula: {0} (CAS {1})

3-cyclohexylpropanoyl chloride (CAS 39098-75-4) is a chemical compound with the molecular formula C9H15ClO and a molecular weight of 174.67 g/mol. IUPAC name: 3-cyclohexylpropanoyl chloride. InChIKey: JUADTOTVJUYCRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15ClO
Molecular weight174.67 g/mol
IUPAC name3-cyclohexylpropanoyl chloride
InChIKeyJUADTOTVJUYCRQ-UHFFFAOYSA-N
SMILESC1CCC(CC1)CCC(=O)Cl

Computed by PubChem (NCBI)