CAS 391-26-4 appears in our catalog under these names: 1-Fluoro-9H-carbazole, 95-<97%, 1-Fluoro-9H-carbazole, 1-Fluoro-9H-carbazole 95%, 1-Fluoro-9H-carbazole, 95%, 95%, 1-Fluoro-9H-carbazole, 96%. Offered by: Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 1g, 100g, 100mg.
1-fluoro-9H-carbazole (CAS 391-26-4) is a chemical compound with the molecular formula C12H8FN and a molecular weight of 185.20 g/mol. IUPAC name: 1-fluoro-9H-carbazole. InChIKey: HPJCIBVGJBEJPU-UHFFFAOYSA-N.
| Molecular formula | C12H8FN |
|---|---|
| Molecular weight | 185.20 g/mol |
| IUPAC name | 1-fluoro-9H-carbazole |
| InChIKey | HPJCIBVGJBEJPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=CC=C3)F |
Computed by PubChem (NCBI)