CAS 391-70-8 is the registry number for Troxonium tosylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
4-methylbenzenesulfonate;triethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium (CAS 391-70-8) is a chemical compound with the molecular formula C25H37NO8S and a molecular weight of 511.6 g/mol. IUPAC name: 4-methylbenzenesulfonate;triethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium. InChIKey: LZMHPQDAYHVLMG-UHFFFAOYSA-M.
| Molecular formula | C25H37NO8S |
|---|---|
| Molecular weight | 511.6 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;triethyl-[2-(3,4,5-trimethoxybenzoyl)oxyethyl]azanium |
| InChIKey | LZMHPQDAYHVLMG-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CCOC(=O)C1=CC(=C(C(=C1)OC)OC)OC.CC1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)