CAS 3910-35-8 appears in our catalog under these names: 1,1,3-Trimethyl-3-phenyl-2,3-dihydro-1h-indene, 98%, 1,1,3-Trimethyl-3-phenyl-2,3-dihydro-1H-indene, 1,1,3-Trimethyl-3-phenylindane, >98.0%(GC), 1,1,3-Trimethyl-3-phenyl-2,3-dihydro-1H-indene 98%, 1,1,3-Trimethyl-3-phenyl-2,3-dihydro-1H-indene, 98%, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100g, 25g, 10g, 50g, 250mg, 100mg.
1,1,3-trimethyl-3-phenyl-2H-indene (CAS 3910-35-8) is a chemical compound with the molecular formula C18H20 and a molecular weight of 236.4 g/mol. IUPAC name: 1,1,3-trimethyl-3-phenyl-2H-indene. InChIKey: ICLPNZMYHDVKKI-UHFFFAOYSA-N.
| Molecular formula | C18H20 |
|---|---|
| Molecular weight | 236.4 g/mol |
| IUPAC name | 1,1,3-trimethyl-3-phenyl-2H-indene |
| InChIKey | ICLPNZMYHDVKKI-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=CC=CC=C21)(C)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)