CAS 391211-97-5 appears in our catalog under these names: 3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)benzoic acid, 97%, 97%, 2-(2-Fluoro-4-iodoanilino)-3,4-difluorobenzoic Acid, >95% (HPLC), 3,4–Difluoro–2–(2–fluoro–4–iodophenylamino)benzoic acid, 2-(2-Fluoro-4-iodoanilino)-3,4-difluorobenzoic acid, 3,4-Difluoro-2-((2-fluoro-4-iodophenyl)amino)benzoic acid, 98%. Offered by: Chemat, TRC, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g.
3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoic acid (CAS 391211-97-5) is a chemical compound with the molecular formula C13H7F3INO2 and a molecular weight of 393.10 g/mol. IUPAC name: 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoic acid. InChIKey: REMYZOSCCVDLDL-UHFFFAOYSA-N.
| Molecular formula | C13H7F3INO2 |
|---|---|
| Molecular weight | 393.10 g/mol |
| IUPAC name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzoic acid |
| InChIKey | REMYZOSCCVDLDL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)F)NC2=C(C=CC(=C2F)F)C(=O)O |
Computed by PubChem (NCBI)